N-Me-4C-T
1-[2,5-Dimethoxy-4-(methylsulfanyl)phenyl]-N-methylbutan-2-amine
 7366 C14H23NO2S 269.403
 InChI=1S/C14H23NO2S/c1-6-11(15-2)7-10-8-13(17-4)14(18-5)9-12(10)16-3/h8-9,11,15H,6-7H2,1-5H3
 VDSMOAJRXWDJOF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cc(OC)c(cc1OC)SC)NC