2-Cl-4,5-DMPEA
2-(2-Chloro-4,5-dimethoxyphenyl)ethan-1-amine
 7314 C10H14ClNO2 215.677
 InChI=1S/C10H14ClNO2/c1-13-9-5-7(3-4-12)8(11)6-10(9)14-2/h5-6H,3-4,12H2,1-2H3
 DHMSGUTWLHFESS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1Cl)OC