5-DHP-DMT
2-(3,7-Dihydropyrano[3,2-e]indol-1-yl)-N,N-dimethylethan-1-amine
 7271  C15H18N2O  242.316
 Prophetic?
 InChI=1S/C15H18N2O/c1-17(2)8-7-11-10-16-13-5-6-14-12(15(11)13)4-3-9-18-14/h3-6,10,16H,7-9H2,1-2H3
 BFPFTNHKGNKPIK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1c1C=CCOc1cc2)C