DOHM
4-(2-Aminopropyl)-2,5-dimethoxybenzaldehyde
 7254  C12H17NO3  223.268
 InChI=1S/C12H17NO3/c1-8(13)4-9-5-12(16-3)10(7-14)6-11(9)15-2/h5-8H,4,13H2,1-3H3
 DNFAIVPALXHIOA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)c(cc1CC(N)C)OC