2C-MAL-2
2-[4-(But-3-en-2-yl)-2,5-dimethoxyphenyl]ethan-1-amine
 7251 C14H21NO2 235.322
 Prophetic?
 InChI=1S/C14H21NO2/c1-5-10(2)12-9-13(16-3)11(6-7-15)8-14(12)17-4/h5,8-10H,1,6-7,15H2,2-4H3
 QQIBCYSDBFCZOP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C(C=C)C