2C-OXO2M
2-{2,5-Dimethoxy-4-[(oxolan-2-yl)methyl]phenyl}ethan-1-amine
 7233  C15H23NO3  265.348
 Prophetic?
 InChI=1S/C15H23NO3/c1-17-14-10-12(8-13-4-3-7-19-13)15(18-2)9-11(14)5-6-16/h9-10,13H,3-8,16H2,1-2H3
 NPWMSKNVZYNRFJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CC1CCCO1