2C-OXET-2
2-[2,5-Dimethoxy-4-(oxetan-2-yl)phenyl]ethan-1-amine
 7226 C13H19NO3 237.295
 Prophetic?
 InChI=1S/C13H19NO3/c1-15-12-8-10(11-4-6-17-11)13(16-2)7-9(12)3-5-14/h7-8,11H,3-6,14H2,1-2H3
 BOCBRGZTPLGYHM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C1CCO1