2C-CB
2-(4-Cyclobutyl-2,5-dimethoxyphenyl)ethan-1-amine
 7222 C14H21NO2 235.322
 Prophetic?
 InChI=1S/C14H21NO2/c1-16-13-9-12(10-4-3-5-10)14(17-2)8-11(13)6-7-15/h8-10H,3-7,15H2,1-2H3
 IJPXPHSEGLKOSB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C1CCC1