2C-FP
2-[4-(3-Fluoropropyl)-2,5-dimethoxyphenyl]ethan-1-amine
 7218  C13H20FNO2  241.302
 Prophetic?
 InChI=1S/C13H20FNO2/c1-16-12-9-11(5-7-15)13(17-2)8-10(12)4-3-6-14/h8-9H,3-7,15H2,1-2H3
 VMCXWURSAVARMD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CCCF