2C-MBM
2-{2,5-Dimethoxy-4-[(3-methoxyphenyl)methyl]phenyl}ethan-1-amine
 7208 C18H23NO3 301.38
 Prophetic?
 InChI=1S/C18H23NO3/c1-20-16-6-4-5-13(10-16)9-15-12-17(21-2)14(7-8-19)11-18(15)22-3/h4-6,10-12H,7-9,19H2,1-3H3
 VPAGHSWGIFKKQM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)Cc1cccc(c1)OC