2C-BN
2-(4-Benzyl-2,5-dimethoxyphenyl)ethan-1-amine
 7207  C17H21NO2  271.354
 Prophetic?
 InChI=1S/C17H21NO2/c1-19-16-12-15(10-13-6-4-3-5-7-13)17(20-2)11-14(16)8-9-18/h3-7,11-12H,8-10,18H2,1-2H3
 VVSQJDCAVXVBQP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)Cc1ccccc1