2C-MAL
2-[2,5-Dimethoxy-4-(2-methylprop-2-en-1-yl)phenyl]ethan-1-amine
 7206 C14H21NO2 235.322
 Prophetic?
 InChI=1S/C14H21NO2/c1-10(2)7-12-9-13(16-3)11(5-6-15)8-14(12)17-4/h8-9H,1,5-7,15H2,2-4H3
 NRGLHFAGBUDHBH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)CC(=C)C