1-Pentylindole
1-Pentyl-1H-indole
 7191 C13H17N 187.281
 InChI=1S/C13H17N/c1-2-3-6-10-14-11-9-12-7-4-5-8-13(12)14/h4-5,7-9,11H,2-3,6,10H2,1H3
 QWLCOOAYMQWDPR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1ccc2c1cccc2