BiPICANNA
N-(Naphthalen-1-yl)-1-pentyl-N-(1-pentyl-1H-indole-3-carbonyl)-1H-indole-3-carboxamide
 7187 C38H39N3O2 569.735
 Cannabinoid
 InChI=1S/C38H39N3O2/c1-3-5-13-24-39-26-32(30-19-9-11-21-34(30)39)37(42)41(36-23-15-17-28-16-7-8-18-29(28)36)38(43)33-27-40(25-14-6-4-2)35-22-12-10-20-31(33)35/h7-12,15-23,26-27H,3-6,13-14,24-25H2,1-2H3
 RLHVMBIFOGDFEB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1cc(c2c1cccc2)C(=O)N(C(=O)c1cn(c2c1cccc2)CCCCC)c1cccc2c1cccc2