2,5-INHeNMeA
N-[1-(4-Iodo-2,5-dimethoxyphenyl)propan-2-yl]-N-methylhexan-1-amine
 7177 C18H30INO2 419.341
 InChI=1S/C18H30INO2/c1-6-7-8-9-10-20(3)14(2)11-15-12-18(22-5)16(19)13-17(15)21-4/h12-14H,6-11H2,1-5H3
 HOLRLPWKQWFDEU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCN(C(Cc1cc(OC)c(cc1OC)I)C)C