2,5-INMeOEtA
1-(4-Iodo-2,5-dimethoxyphenyl)-N-(2-methoxyethyl)propan-2-amine
 7168 C14H22INO3 379.234
 InChI=1S/C14H22INO3/c1-10(16-5-6-17-2)7-11-8-14(19-4)12(15)9-13(11)18-3/h8-10,16H,5-7H2,1-4H3
 UEJGXCYIUOPRDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCNC(Cc1cc(OC)c(cc1OC)I)C