BOI
2-(4-Iodo-2,5-dimethoxyphenyl)-2-methoxyethan-1-amine
 7161 C11H16INO3 337.154
 InChI=1S/C11H16INO3/c1-14-9-5-8(12)10(15-2)4-7(9)11(6-13)16-3/h4-5,11H,6,13H2,1-3H3
 PPHHUNXXWCQIJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(c1cc(OC)c(cc1OC)I)CN