N-Acetyl-DOM
N-[1-(2,5-Dimethoxy-4-methylphenyl)propan-2-yl]acetamide
 7131 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-9-6-14(18-5)12(8-13(9)17-4)7-10(2)15-11(3)16/h6,8,10H,7H2,1-5H3,(H,15,16)
 MPYLNWVCOIYJAT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CC(NC(=O)C)C)OC