DOC-Ac
N-[1-(4-Chloro-2,5-dimethoxyphenyl)propan-2-yl]acetamide
 7121 C13H18ClNO3 271.74
 InChI=1S/C13H18ClNO3/c1-8(15-9(2)16)5-10-6-13(18-4)11(14)7-12(10)17-3/h6-8H,5H2,1-4H3,(H,15,16)
 NVNLBCVCSYNKHG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Cl)c(cc1CC(NC(=O)C)C)OC