2,5-HO-MPEA
2-(2-Aminoethyl)-5-methoxybenzene-1,4-diol
 7116 C9H13NO3 183.204
 InChI=1S/C9H13NO3/c1-13-9-5-7(11)6(2-3-10)4-8(9)12/h4-5,11-12H,2-3,10H2,1H3
 QJPNZUPVNUCQJP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(cc1O)OC