THMA-2
5-[2-(Methylamino)propyl]benzene-1,2,4-triol
 7115 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-6(11-2)3-7-4-9(13)10(14)5-8(7)12/h4-6,11-14H,3H2,1-2H3
 YTALUFDCWBLHNU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC)Cc1cc(O)c(cc1O)O