4,5-HO-2-AA
4-Amino-5-(2-aminopropyl)benzene-1,2-diol
 7112 C9H14N2O2 182.22
 InChI=1S/C9H14N2O2/c1-5(10)2-6-3-8(12)9(13)4-7(6)11/h3-5,12-13H,2,10-11H2,1H3
 PATKONGWKTXWGG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(O)c(cc1N)O)N