4,5-HO-2-APEA
4-Amino-5-(2-aminoethyl)benzene-1,2-diol
 7111 C8H12N2O2 168.193
 InChI=1S/C8H12N2O2/c9-2-1-5-3-7(11)8(12)4-6(5)10/h3-4,11-12H,1-2,9-10H2
 JOMLIKNXFZFNRZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(cc1N)O