2,5-HO-PAA
2-Amino-5-(2-aminopropyl)benzene-1,4-diol
 7108 C9H14N2O2 182.22
 InChI=1S/C9H14N2O2/c1-5(10)2-6-3-9(13)7(11)4-8(6)12/h3-5,12-13H,2,10-11H2,1H3
 ZGIUXHIVYLIJLG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(O)c(cc1O)N)N