2,5-HO-4-APEA
2-Amino-5-(2-aminoethyl)benzene-1,4-diol
 7107 C8H12N2O2 168.193
 InChI=1S/C8H12N2O2/c9-2-1-5-3-8(12)6(10)4-7(5)11/h3-4,11-12H,1-2,9-10H2
 RSBNOZFUFIGWRG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(cc1O)N