TMeA-2
1-(2,4,5-Trimethylphenyl)propan-2-amine
 7104 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-5-10(3)12(6-9(8)2)7-11(4)13/h5-6,11H,7,13H2,1-4H3
 IISPNTJZFIEFFK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(C)c(cc1C)C)N