TMePEA-2
2-(2,4,5-Trimethylphenyl)ethan-1-amine
 7103 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-6-10(3)11(4-5-12)7-9(8)2/h6-7H,4-5,12H2,1-3H3
 YXHQCTYIPCCUFC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)c(cc1C)C