5-NH2-2,4-DMA
5-(2-Aminopropyl)-2,4-dimethoxyaniline
 7102 C11H18N2O2 210.273
 InChI=1S/C11H18N2O2/c1-7(12)4-8-5-9(13)11(15-3)6-10(8)14-2/h5-7H,4,12-13H2,1-3H3
 GPLJWKBNYXUQHX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)c(cc1CC(N)C)N