4-MeA-TFA
2,2,2-Trifluoro-N-[1-(4-methylphenyl)propan-2-yl]acetamide
 7092  C12H14F3NO  245.241
 InChI=1S/C12H14F3NO/c1-8-3-5-10(6-4-8)7-9(2)16-11(17)12(13,14)15/h3-6,9H,7H2,1-2H3,(H,16,17)
 UUQOSASTZRRNMT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)C)NC(=O)C(F)(F)F