2,4-HO-5-APEA
4-Amino-6-(2-aminoethyl)benzene-1,3-diol
 7083 C8H12N2O2 168.193
 InChI=1S/C8H12N2O2/c9-2-1-5-3-6(10)8(12)4-7(5)11/h3-4,11-12H,1-2,9-10H2
 JWELJDPOXNWIRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(N)c(cc1O)O