2,5,3-2C-T-7
1-[2,5-Dimethoxy-3-(propylsulfanyl)phenyl]propan-2-amine
 7064 C14H23NO2S 269.403
 InChI=1S/C14H23NO2S/c1-5-6-18-13-9-12(16-3)8-11(7-10(2)15)14(13)17-4/h8-10H,5-7,15H2,1-4H3
 JZHNOQQFNYDATF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)cc(c1OC)CC(N)C