TMePEA-4
2-(2,3,5-Trimethylphenyl)ethan-1-amine
 7055 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-6-9(2)10(3)11(7-8)4-5-12/h6-7H,4-5,12H2,1-3H3
 UIJAHLCIYPUBPA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)cc(c1C)C