2-(2,3,6,7-Tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-9-yl)ethan-1-amine
 705 C14H20N2 216.322
 InChI=1S/C14H20N2/c15-6-5-11-9-12-3-1-7-16-8-2-4-13(10-11)14(12)16/h9-10H,1-8,15H2
 NIFACYIMVREXSO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc2CCCN3c2c(c1)CCC3