2C-T-2-OH
2-{[4-(2-Aminoethyl)-2,5-dimethoxyphenyl]sulfanyl}ethan-1-ol
 7034  C12H19NO3S  257.349
 InChI=1S/C12H19NO3S/c1-15-10-8-12(17-6-5-14)11(16-2)7-9(10)3-4-13/h7-8,14H,3-6,13H2,1-2H3
 NHZDUZPZMPAAIE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SCCO