ADB-BUTINACA
N-(1-Amino-3,3-dimethyl-1-oxobutan-2-yl)-1-butyl-1H-indazole-3-carboxamide
 6995  C18H26N4O2  330.425
 Cannabinoid
 InChI=1S/C18H26N4O2/c1-5-6-11-22-13-10-8-7-9-12(13)14(21-22)17(24)20-15(16(19)23)18(2,3)4/h7-10,15H,5-6,11H2,1-4H3,(H2,19,23)(H,20,24)
 GPWADXHYJAZPAX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCn1nc(c2c1cccc2)C(=O)NC(C(C)(C)C)C(=O)N