4-Methylpropiophenone
1-(4-Methylphenyl)propan-1-one
 6989  C10H12O  148.202
 InChI=1S/C10H12O/c1-3-10(11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3
 PATYHUUYADUHQS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)c1ccc(cc1)C