TMePEA-3
2-(2,3,4-Trimethylphenyl)ethan-1-amine
 6978 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-4-5-11(6-7-12)10(3)9(8)2/h4-5H,6-7,12H2,1-3H3
 MKWLNGKKQKTMIK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1C)C)C