2,6-DMePEA
2-(2,6-Dimethylphenyl)ethan-1-amine
 6953 C10H15N 149.233
 InChI=1S/C10H15N/c1-8-4-3-5-9(2)10(8)6-7-11/h3-5H,6-7,11H2,1-2H3
 NVXJQKFBPRPHND-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)cccc1C