3,5-DMeA
1-(3,5-Dimethylphenyl)propan-2-amine
 6919 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-4-9(2)6-11(5-8)7-10(3)12/h4-6,10H,7,12H2,1-3H3
 GQTBQUZZFQMYHK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(C)cc(c1)C)N