3,5-DMePEA
2-(3,5-Dimethylphenyl)ethan-1-amine
 6918 C10H15N 149.233
 InChI=1S/C10H15N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3-4,11H2,1-2H3
 QXLUHUARYCYCMG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)cc(c1)C