2,5-DEA-βk
2-Amino-1-(2,5-diethoxyphenyl)propan-1-one
 6917 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-4-16-10-6-7-12(17-5-2)11(8-10)13(15)9(3)14/h6-9H,4-5,14H2,1-3H3
 XBWVJUXKMZSKCY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(c(c1)C(=O)C(N)C)OCC