β,2-HO-5-EPEA
2-(2-Amino-1-hydroxyethyl)-4-ethoxyphenol
 6905 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-2-14-7-3-4-9(12)8(5-7)10(13)6-11/h3-5,10,12-13H,2,6,11H2,1H3
 XUDKLPPBUGUYAB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(c(c1)C(CN)O)O