2,5-DMA-Ac
Methyl [1-(2,5-dimethoxyphenyl)propan-2-yl]carbamate
 6873 C13H19NO4 253.294
 InChI=1S/C13H19NO4/c1-9(14-13(15)18-4)7-10-8-11(16-2)5-6-12(10)17-3/h5-6,8-9H,7H2,1-4H3,(H,14,15)
 DYFXJMGBBKCTAK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(=O)NC(Cc1cc(OC)ccc1OC)C