β,2-HO-5-MA
2-(2-Amino-1-hydroxypropyl)-4-methoxyphenol
 6855 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-6(11)10(13)8-5-7(14-2)3-4-9(8)12/h3-6,10,12-13H,11H2,1-2H3
 LTRYNFZJMRMHMJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1)C(C(N)C)O)O