β,2-HO-N-Me-5-MPEA
2-[1-Hydroxy-2-(methylamino)ethyl]-4-methoxyphenol
 6851 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-11-6-10(13)8-5-7(14-2)3-4-9(8)12/h3-5,10-13H,6H2,1-2H3
 DSGJJVGCMGXOJJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1cc(OC)ccc1O)O