2-I-5-MA
1-(2-Iodo-5-methoxyphenyl)propan-2-amine
 6828  C10H14INO  291.129
 InChI=1S/C10H14INO/c1-7(12)5-8-6-9(13-2)3-4-10(8)11/h3-4,6-7H,5,12H2,1-2H3
 HNCBMPQXKJBONO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1)CC(N)C)I