β,5-HO-N-Me-2-MPEA
3-[1-Hydroxy-2-(methylamino)ethyl]-4-methoxyphenol
 6824 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-11-6-9(13)8-5-7(12)3-4-10(8)14-2/h3-5,9,11-13H,6H2,1-2H3
 YZQCLAHERDJGHU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1cc(O)ccc1OC)O