N-Me-2,5-DMeA
2-(2,5-Dimethylphenyl)-N-methylethan-1-amine
 6810 C11H17N 163.259
 InChI=1S/C11H17N/c1-9-4-5-10(2)11(8-9)6-7-12-3/h4-5,8,12H,6-7H2,1-3H3
 UORINXKKLPMLMW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1cc(C)ccc1C