2,5-DMePEA
2-(2,5-Dimethylphenyl)ethan-1-amine
 6808 C10H15N 149.233
 InChI=1S/C10H15N/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7H,5-6,11H2,1-2H3
 RNEFNTMBBIKOFO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(cc1CCN)C