EDEA
1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-N-ethylpropan-2-amine
 6803 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-3-14-10(2)8-11-4-5-12-13(9-11)16-7-6-15-12/h4-5,9-10,14H,3,6-8H2,1-2H3
 ZLEDMSKAMRETIN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1ccc2c(c1)OCCO2)C